C35H32N2O6 — CID 10769498
benzyl 3-[(2R)-2-methyl-3-oxo-3-phenylmethoxy-2-(phenylmethoxycarbonylamino)propyl]indole-1-carboxylate (PubChem CID 10769498) has the molecular formula C35H32N2O6 and a molecular weight of 576.65 g/mol. Its IUPAC name is benzyl 3-[(2R)-2-methyl-3-oxo-3-phenylmethoxy-2-(phenylmethoxycarbonylamino)propyl]indole-1-carboxylate.
| Compound Name | benzyl 3-[(2R)-2-methyl-3-oxo-3-phenylmethoxy-2-(phenylmethoxycarbonylamino)propyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 10769498 |
| Molecular Formula | C35H32N2O6 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | benzyl 3-[(2R)-2-methyl-3-oxo-3-phenylmethoxy-2-(phenylmethoxycarbonylamino)propyl]indole-1-carboxylate |
| SMILES | C[C@](Cc1cn(C(=O)OCc2ccccc2)c2ccccc12)(NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H32N2O6/c1-35(32(38)41-23-26-13-5-2-6-14-26,36-33(39)42-24-27-15-7-3-8-16-27)21-29-22-37(31-20-12-11-19-30(29)31)34(40)43-25-28-17-9-4-10-18-28/h2-20,22H,21,23-25H2,1H3,(H,36,39)/t35-/m1/s1 |
| InChIKey | OSPYEOVNWSBSCH-PGUFJCEWSA-N |
| XLogP | 6.80 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|