C32H30N3O9P — CID 70206677
CID 70206677 (PubChem CID 70206677) has the molecular formula C32H30N3O9P and a molecular weight of 631.58 g/mol.
| Compound Name | CID 70206677 |
|---|---|
| PubChem CID | 70206677 |
| Molecular Formula | C32H30N3O9P |
| Molecular Weight | 631.58 g/mol |
| Exact Mass | 631.17 |
| IUPAC Name | — |
| SMILES | CC(NC(=O)C(C)(Cc1cn(C(=O)OCOP(=O)=O)c2ccccc12)NC(=O)OCc1cc2ccccc2o1)c1ccccc1 |
| InChI | InChI=1S/C32H30N3O9P/c1-21(22-10-4-3-5-11-22)33-29(36)32(2,34-30(37)41-19-25-16-23-12-6-9-15-28(23)44-25)17-24-18-35(27-14-8-7-13-26(24)27)31(38)42-20-43-45(39)40/h3-16,18,21H,17,19-20H2,1-2H3,(H,33,36)(H,34,37) |
| InChIKey | XIFOGMWBAOCXGV-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 155.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.58 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|