C31H34N4O2 — CID 18409670
2-(1-benzofuran-2-ylmethylamino)-N-[1-[4-(dimethylamino)phenyl]ethyl]-3-(1H-indol-3-yl)-2-methylpropanamide (PubChem CID 18409670) has the molecular formula C31H34N4O2 and a molecular weight of 494.64 g/mol. Its IUPAC name is 2-(1-benzofuran-2-ylmethylamino)-N-[1-[4-(dimethylamino)phenyl]ethyl]-3-(1H-indol-3-yl)-2-methylpropanamide.
| Compound Name | 2-(1-benzofuran-2-ylmethylamino)-N-[1-[4-(dimethylamino)phenyl]ethyl]-3-(1H-indol-3-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 18409670 |
| Molecular Formula | C31H34N4O2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 2-(1-benzofuran-2-ylmethylamino)-N-[1-[4-(dimethylamino)phenyl]ethyl]-3-(1H-indol-3-yl)-2-methylpropanamide |
| SMILES | CC(NC(=O)C(C)(Cc1c[nH]c2ccccc12)NCc1cc2ccccc2o1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C31H34N4O2/c1-21(22-13-15-25(16-14-22)35(3)4)34-30(36)31(2,18-24-19-32-28-11-7-6-10-27(24)28)33-20-26-17-23-9-5-8-12-29(23)37-26/h5-17,19,21,32-33H,18,20H2,1-4H3,(H,34,36) |
| InChIKey | HPSMGVFRDDCZHU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|