C29H29N3O2 — CID 18409589
2-(1-benzofuran-2-ylmethylamino)-3-(1H-indol-3-yl)-2-methyl-N-(1-phenylethyl)propanamide (PubChem CID 18409589) has the molecular formula C29H29N3O2 and a molecular weight of 451.57 g/mol. Its IUPAC name is 2-(1-benzofuran-2-ylmethylamino)-3-(1H-indol-3-yl)-2-methyl-N-(1-phenylethyl)propanamide.
| Compound Name | 2-(1-benzofuran-2-ylmethylamino)-3-(1H-indol-3-yl)-2-methyl-N-(1-phenylethyl)propanamide |
|---|---|
| PubChem CID | 18409589 |
| Molecular Formula | C29H29N3O2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 2-(1-benzofuran-2-ylmethylamino)-3-(1H-indol-3-yl)-2-methyl-N-(1-phenylethyl)propanamide |
| SMILES | CC(NC(=O)C(C)(Cc1c[nH]c2ccccc12)NCc1cc2ccccc2o1)c1ccccc1 |
| InChI | InChI=1S/C29H29N3O2/c1-20(21-10-4-3-5-11-21)32-28(33)29(2,17-23-18-30-26-14-8-7-13-25(23)26)31-19-24-16-22-12-6-9-15-27(22)34-24/h3-16,18,20,30-31H,17,19H2,1-2H3,(H,32,33) |
| InChIKey | QFAJKIGTJVLZIC-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |