C30H31N3O2 — CID 18409750
2-(1-benzofuran-2-ylmethylamino)-3-(1H-indol-3-yl)-2-methyl-N-(2-phenylpropyl)propanamide (PubChem CID 18409750) has the molecular formula C30H31N3O2 and a molecular weight of 465.60 g/mol. Its IUPAC name is 2-(1-benzofuran-2-ylmethylamino)-3-(1H-indol-3-yl)-2-methyl-N-(2-phenylpropyl)propanamide.
| Compound Name | 2-(1-benzofuran-2-ylmethylamino)-3-(1H-indol-3-yl)-2-methyl-N-(2-phenylpropyl)propanamide |
|---|---|
| PubChem CID | 18409750 |
| Molecular Formula | C30H31N3O2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 2-(1-benzofuran-2-ylmethylamino)-3-(1H-indol-3-yl)-2-methyl-N-(2-phenylpropyl)propanamide |
| SMILES | CC(CNC(=O)C(C)(Cc1c[nH]c2ccccc12)NCc1cc2ccccc2o1)c1ccccc1 |
| InChI | InChI=1S/C30H31N3O2/c1-21(22-10-4-3-5-11-22)18-32-29(34)30(2,17-24-19-31-27-14-8-7-13-26(24)27)33-20-25-16-23-12-6-9-15-28(23)35-25/h3-16,19,21,31,33H,17-18,20H2,1-2H3,(H,32,34) |
| InChIKey | DRBQLTOWKSWKOP-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |