C40H38N3O12P — CID 15524070
[4-(phosphonooxymethyl)benzoyl]oxymethyl 3-[(2R)-2-(1-benzofuran-2-ylmethoxycarbonylamino)-2-methyl-3-oxo-3-[[(1S)-1-phenylethyl]amino]propyl]indole-1-carboxylate (PubChem CID 15524070) has the molecular formula C40H38N3O12P and a molecular weight of 783.73 g/mol. Its IUPAC name is [4-(phosphonooxymethyl)benzoyl]oxymethyl 3-[(2R)-2-(1-benzofuran-2-ylmethoxycarbonylamino)-2-methyl-3-oxo-3-[[(1S)-1-phenylethyl]amino]propyl]indole-1-carboxylate.
| Compound Name | [4-(phosphonooxymethyl)benzoyl]oxymethyl 3-[(2R)-2-(1-benzofuran-2-ylmethoxycarbonylamino)-2-methyl-3-oxo-3-[[(1S)-1-phenylethyl]amino]propyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 15524070 |
| Molecular Formula | C40H38N3O12P |
| Molecular Weight | 783.73 g/mol |
| Exact Mass | 783.22 |
| IUPAC Name | [4-(phosphonooxymethyl)benzoyl]oxymethyl 3-[(2R)-2-(1-benzofuran-2-ylmethoxycarbonylamino)-2-methyl-3-oxo-3-[[(1S)-1-phenylethyl]amino]propyl]indole-1-carboxylate |
| SMILES | C[C@H](NC(=O)[C@@](C)(Cc1cn(C(=O)OCOC(=O)c2ccc(COP(=O)(O)O)cc2)c2ccccc12)NC(=O)OCc1cc2ccccc2o1)c1ccccc1 |
| InChI | InChI=1S/C40H38N3O12P/c1-26(28-10-4-3-5-11-28)41-37(45)40(2,42-38(46)51-24-32-20-30-12-6-9-15-35(30)55-32)21-31-22-43(34-14-8-7-13-33(31)34)39(47)53-25-52-36(44)29-18-16-27(17-19-29)23-54-56(48,49)50/h3-20,22,26H,21,23-25H2,1-2H3,(H,41,45)(H,42,46)(H2,48,49,50)/t26-,40+/m0/s1 |
| InChIKey | HWQWRDCPBHSHCR-HHUGKLBUSA-N |
| XLogP | 6.90 |
| TPSA | 204.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.73 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|