C32H32N2O6 — CID 163579292
benzyl 6-methyl-3-[(Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-phenylmethoxyprop-1-enyl]indole-1-carboxylate (PubChem CID 163579292) has the molecular formula C32H32N2O6 and a molecular weight of 540.62 g/mol. Its IUPAC name is benzyl 6-methyl-3-[(Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-phenylmethoxyprop-1-enyl]indole-1-carboxylate.
| Compound Name | benzyl 6-methyl-3-[(Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-phenylmethoxyprop-1-enyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 163579292 |
| Molecular Formula | C32H32N2O6 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | benzyl 6-methyl-3-[(Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-phenylmethoxyprop-1-enyl]indole-1-carboxylate |
| SMILES | Cc1ccc2c(/C=C(\NC(=O)OC(C)(C)C)C(=O)OCc3ccccc3)cn(C(=O)OCc3ccccc3)c2c1 |
| InChI | InChI=1S/C32H32N2O6/c1-22-15-16-26-25(19-34(28(26)17-22)31(37)39-21-24-13-9-6-10-14-24)18-27(33-30(36)40-32(2,3)4)29(35)38-20-23-11-7-5-8-12-23/h5-19H,20-21H2,1-4H3,(H,33,36)/b27-18- |
| InChIKey | DBWDJUAWPBILKQ-IMRQLAEWSA-N |
| XLogP | 6.74 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|