C25H27N3O6 — CID 130476353
methyl (E)-3-[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pyrrolo[3,2-c]pyridin-3-yl]-2-(phenylmethoxycarbonylamino)prop-2-enoate (PubChem CID 130476353) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is methyl (E)-3-[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pyrrolo[3,2-c]pyridin-3-yl]-2-(phenylmethoxycarbonylamino)prop-2-enoate.
| Compound Name | methyl (E)-3-[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pyrrolo[3,2-c]pyridin-3-yl]-2-(phenylmethoxycarbonylamino)prop-2-enoate |
|---|---|
| PubChem CID | 130476353 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | methyl (E)-3-[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pyrrolo[3,2-c]pyridin-3-yl]-2-(phenylmethoxycarbonylamino)prop-2-enoate |
| SMILES | COC(=O)/C(=C\c1cn(CC(=O)OC(C)(C)C)c2ccncc12)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H27N3O6/c1-25(2,3)34-22(29)15-28-14-18(19-13-26-11-10-21(19)28)12-20(23(30)32-4)27-24(31)33-16-17-8-6-5-7-9-17/h5-14H,15-16H2,1-4H3,(H,27,31)/b20-12+ |
| InChIKey | QUGRNPIOMYAUGI-UDWIEESQSA-N |
| XLogP | 3.82 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|