C25H28N2O4 — CID 169472974
tert-butyl 2-[3-[3-(phenylmethoxycarbonylamino)prop-1-enyl]indol-1-yl]acetate (PubChem CID 169472974) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is tert-butyl 2-[3-[3-(phenylmethoxycarbonylamino)prop-1-enyl]indol-1-yl]acetate.
| Compound Name | tert-butyl 2-[3-[3-(phenylmethoxycarbonylamino)prop-1-enyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 169472974 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | tert-butyl 2-[3-[3-(phenylmethoxycarbonylamino)prop-1-enyl]indol-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)Cn1cc(C=CCNC(=O)OCc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C25H28N2O4/c1-25(2,3)31-23(28)17-27-16-20(21-13-7-8-14-22(21)27)12-9-15-26-24(29)30-18-19-10-5-4-6-11-19/h4-14,16H,15,17-18H2,1-3H3,(H,26,29) |
| InChIKey | LVPLCDQFUMCBLT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |