C19H21NO4S — CID 11439796
benzyl (Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-2-ylprop-2-enoate (PubChem CID 11439796) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is benzyl (Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-2-ylprop-2-enoate.
| Compound Name | benzyl (Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 11439796 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | benzyl (Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-2-ylprop-2-enoate |
| SMILES | CC(C)(C)OC(=O)N/C(=C\c1cccs1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H21NO4S/c1-19(2,3)24-18(22)20-16(12-15-10-7-11-25-15)17(21)23-13-14-8-5-4-6-9-14/h4-12H,13H2,1-3H3,(H,20,22)/b16-12- |
| InChIKey | HKCQMQQGVCTUPP-VBKFSLOCSA-N |
| XLogP | 4.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|