C22H22BrN3O2S — CID 146417008
tert-butyl (Z)-2-[(3-benzyl-5-bromopyrazin-2-yl)amino]-3-thiophen-2-ylprop-2-enoate (PubChem CID 146417008) has the molecular formula C22H22BrN3O2S and a molecular weight of 472.41 g/mol. Its IUPAC name is tert-butyl (Z)-2-[(3-benzyl-5-bromopyrazin-2-yl)amino]-3-thiophen-2-ylprop-2-enoate.
| Compound Name | tert-butyl (Z)-2-[(3-benzyl-5-bromopyrazin-2-yl)amino]-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 146417008 |
| Molecular Formula | C22H22BrN3O2S |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | tert-butyl (Z)-2-[(3-benzyl-5-bromopyrazin-2-yl)amino]-3-thiophen-2-ylprop-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C(=C/c1cccs1)Nc1ncc(Br)nc1Cc1ccccc1 |
| InChI | InChI=1S/C22H22BrN3O2S/c1-22(2,3)28-21(27)18(13-16-10-7-11-29-16)26-20-17(25-19(23)14-24-20)12-15-8-5-4-6-9-15/h4-11,13-14H,12H2,1-3H3,(H,24,26)/b18-13- |
| InChIKey | RWSOJVATCCWZLS-AQTBWJFISA-N |
| XLogP | 5.69 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|