C30H38N2O8Si — CID 70270297
(Z)-3-[3-[(Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(2-trimethylsilylethoxy)prop-1-enyl]phenyl]-2-(phenylmethoxycarbonylamino)prop-2-enoic acid (PubChem CID 70270297) has the molecular formula C30H38N2O8Si and a molecular weight of 582.73 g/mol. Its IUPAC name is (Z)-3-[3-[(Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(2-trimethylsilylethoxy)prop-1-enyl]phenyl]-2-(phenylmethoxycarbonylamino)prop-2-enoic acid.
| Compound Name | (Z)-3-[3-[(Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(2-trimethylsilylethoxy)prop-1-enyl]phenyl]-2-(phenylmethoxycarbonylamino)prop-2-enoic acid |
|---|---|
| PubChem CID | 70270297 |
| Molecular Formula | C30H38N2O8Si |
| Molecular Weight | 582.73 g/mol |
| Exact Mass | 582.24 |
| IUPAC Name | (Z)-3-[3-[(Z)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-3-(2-trimethylsilylethoxy)prop-1-enyl]phenyl]-2-(phenylmethoxycarbonylamino)prop-2-enoic acid |
| SMILES | CC(C)(C)OC(=O)N/C(=C\c1cccc(/C=C(\NC(=O)OCc2ccccc2)C(=O)O)c1)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C30H38N2O8Si/c1-30(2,3)40-29(37)32-25(27(35)38-15-16-41(4,5)6)19-23-14-10-13-22(17-23)18-24(26(33)34)31-28(36)39-20-21-11-8-7-9-12-21/h7-14,17-19H,15-16,20H2,1-6H3,(H,31,36)(H,32,37)(H,33,34)/b24-18-,25-19- |
| InChIKey | AONAANRTKWMHBH-GJEUYDLNSA-N |
| XLogP | 5.79 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.73 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|