C17H10ClF4NO3 — CID 118452489
6-[[3-chloro-4-fluoro-5-(trifluoromethyl)anilino]methyl]-1-benzofuran-2-carboxylic acid (PubChem CID 118452489) has the molecular formula C17H10ClF4NO3 and a molecular weight of 387.72 g/mol. Its IUPAC name is 6-[[3-chloro-4-fluoro-5-(trifluoromethyl)anilino]methyl]-1-benzofuran-2-carboxylic acid.
| Compound Name | 6-[[3-chloro-4-fluoro-5-(trifluoromethyl)anilino]methyl]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 118452489 |
| Molecular Formula | C17H10ClF4NO3 |
| Molecular Weight | 387.72 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 6-[[3-chloro-4-fluoro-5-(trifluoromethyl)anilino]methyl]-1-benzofuran-2-carboxylic acid |
| SMILES | O=C(O)c1cc2ccc(CNc3cc(Cl)c(F)c(C(F)(F)F)c3)cc2o1 |
| InChI | InChI=1S/C17H10ClF4NO3/c18-12-6-10(5-11(15(12)19)17(20,21)22)23-7-8-1-2-9-4-14(16(24)25)26-13(9)3-8/h1-6,23H,7H2,(H,24,25) |
| InChIKey | GUSXZNUTTQWJLX-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.72 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |