C9H7ClN2O2S — CID 106686593
2-chloro-N-(1,3-thiazol-2-ylmethyl)furan-3-carboxamide (PubChem CID 106686593) has the molecular formula C9H7ClN2O2S and a molecular weight of 242.69 g/mol. Its IUPAC name is 2-chloro-N-(1,3-thiazol-2-ylmethyl)furan-3-carboxamide.
| Compound Name | 2-chloro-N-(1,3-thiazol-2-ylmethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106686593 |
| Molecular Formula | C9H7ClN2O2S |
| Molecular Weight | 242.69 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 2-chloro-N-(1,3-thiazol-2-ylmethyl)furan-3-carboxamide |
| SMILES | O=C(NCc1nccs1)c1ccoc1Cl |
| InChI | InChI=1S/C9H7ClN2O2S/c10-8-6(1-3-14-8)9(13)12-5-7-11-2-4-15-7/h1-4H,5H2,(H,12,13) |
| InChIKey | QHHOLYIJOHFTAZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.69 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |