C12H8Cl2N2O2 — CID 110692745
N-(3,5-dichlorophenyl)-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 110692745) has the molecular formula C12H8Cl2N2O2 and a molecular weight of 283.11 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110692745 |
| Molecular Formula | C12H8Cl2N2O2 |
| Molecular Weight | 283.11 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)c1ccc[nH]c1=O |
| InChI | InChI=1S/C12H8Cl2N2O2/c13-7-4-8(14)6-9(5-7)16-12(18)10-2-1-3-15-11(10)17/h1-6H,(H,15,17)(H,16,18) |
| InChIKey | OZARXERRCAFPNY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.11 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |