C13H12N2O2S — CID 42371486
N-(4-methylsulfanylphenyl)-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 42371486) has the molecular formula C13H12N2O2S and a molecular weight of 260.32 g/mol. Its IUPAC name is N-(4-methylsulfanylphenyl)-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(4-methylsulfanylphenyl)-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 42371486 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | N-(4-methylsulfanylphenyl)-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | CSc1ccc(NC(=O)c2ccc[nH]c2=O)cc1 |
| InChI | InChI=1S/C13H12N2O2S/c1-18-10-6-4-9(5-7-10)15-13(17)11-3-2-8-14-12(11)16/h2-8H,1H3,(H,14,16)(H,15,17) |
| InChIKey | ZBVYZAJXNKKCGQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |