C14H17ClF2N2O3 — CID 111629766
N'-(2-chloro-4,5-difluorophenyl)-N-(2-hydroxy-3,3-dimethylbutyl)oxamide (PubChem CID 111629766) has the molecular formula C14H17ClF2N2O3 and a molecular weight of 334.75 g/mol. Its IUPAC name is N'-(2-chloro-4,5-difluorophenyl)-N-(2-hydroxy-3,3-dimethylbutyl)oxamide.
| Compound Name | N'-(2-chloro-4,5-difluorophenyl)-N-(2-hydroxy-3,3-dimethylbutyl)oxamide |
|---|---|
| PubChem CID | 111629766 |
| Molecular Formula | C14H17ClF2N2O3 |
| Molecular Weight | 334.75 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | N'-(2-chloro-4,5-difluorophenyl)-N-(2-hydroxy-3,3-dimethylbutyl)oxamide |
| SMILES | CC(C)(C)C(O)CNC(=O)C(=O)Nc1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C14H17ClF2N2O3/c1-14(2,3)11(20)6-18-12(21)13(22)19-10-5-9(17)8(16)4-7(10)15/h4-5,11,20H,6H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | QEDKWIGGRUEWGJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.75 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|