C18H17N3O4 — CID 56801346
N-(3-cyanophenyl)-N'-[1-(2-hydroxy-5-methoxyphenyl)ethyl]oxamide (PubChem CID 56801346) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is N-(3-cyanophenyl)-N'-[1-(2-hydroxy-5-methoxyphenyl)ethyl]oxamide.
| Compound Name | N-(3-cyanophenyl)-N'-[1-(2-hydroxy-5-methoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 56801346 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N-(3-cyanophenyl)-N'-[1-(2-hydroxy-5-methoxyphenyl)ethyl]oxamide |
| SMILES | COc1ccc(O)c(C(C)NC(=O)C(=O)Nc2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C18H17N3O4/c1-11(15-9-14(25-2)6-7-16(15)22)20-17(23)18(24)21-13-5-3-4-12(8-13)10-19/h3-9,11,22H,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | MWSOIQCRIVBYIP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|