C19H21FN2O3 — CID 96532470
N-(4-fluoro-2-methylphenyl)-N'-[(2R)-1-(3-methoxyphenyl)propan-2-yl]oxamide (PubChem CID 96532470) has the molecular formula C19H21FN2O3 and a molecular weight of 344.39 g/mol. Its IUPAC name is N-(4-fluoro-2-methylphenyl)-N'-[(2R)-1-(3-methoxyphenyl)propan-2-yl]oxamide.
| Compound Name | N-(4-fluoro-2-methylphenyl)-N'-[(2R)-1-(3-methoxyphenyl)propan-2-yl]oxamide |
|---|---|
| PubChem CID | 96532470 |
| Molecular Formula | C19H21FN2O3 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N-(4-fluoro-2-methylphenyl)-N'-[(2R)-1-(3-methoxyphenyl)propan-2-yl]oxamide |
| SMILES | COc1cccc(C[C@@H](C)NC(=O)C(=O)Nc2ccc(F)cc2C)c1 |
| InChI | InChI=1S/C19H21FN2O3/c1-12-9-15(20)7-8-17(12)22-19(24)18(23)21-13(2)10-14-5-4-6-16(11-14)25-3/h4-9,11,13H,10H2,1-3H3,(H,21,23)(H,22,24)/t13-/m1/s1 |
| InChIKey | KHIYAXXYJFNHEG-CYBMUJFWSA-N |
| XLogP | 2.83 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|