C23H28ClN3O3 — CID 86943894
N-(5-chloro-2-piperidin-1-ylphenyl)-N'-[1-(3-methoxyphenyl)propan-2-yl]oxamide (PubChem CID 86943894) has the molecular formula C23H28ClN3O3 and a molecular weight of 429.95 g/mol. Its IUPAC name is N-(5-chloro-2-piperidin-1-ylphenyl)-N'-[1-(3-methoxyphenyl)propan-2-yl]oxamide.
| Compound Name | N-(5-chloro-2-piperidin-1-ylphenyl)-N'-[1-(3-methoxyphenyl)propan-2-yl]oxamide |
|---|---|
| PubChem CID | 86943894 |
| Molecular Formula | C23H28ClN3O3 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | N-(5-chloro-2-piperidin-1-ylphenyl)-N'-[1-(3-methoxyphenyl)propan-2-yl]oxamide |
| SMILES | COc1cccc(CC(C)NC(=O)C(=O)Nc2cc(Cl)ccc2N2CCCCC2)c1 |
| InChI | InChI=1S/C23H28ClN3O3/c1-16(13-17-7-6-8-19(14-17)30-2)25-22(28)23(29)26-20-15-18(24)9-10-21(20)27-11-4-3-5-12-27/h6-10,14-16H,3-5,11-13H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | MTZMYNPUIZNKOD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|