C21H25FN2O2 — CID 86943269
1-[cyclopropyl-(4-fluorophenyl)methyl]-3-[1-(3-methoxyphenyl)propan-2-yl]urea (PubChem CID 86943269) has the molecular formula C21H25FN2O2 and a molecular weight of 356.44 g/mol. Its IUPAC name is 1-[cyclopropyl-(4-fluorophenyl)methyl]-3-[1-(3-methoxyphenyl)propan-2-yl]urea.
| Compound Name | 1-[cyclopropyl-(4-fluorophenyl)methyl]-3-[1-(3-methoxyphenyl)propan-2-yl]urea |
|---|---|
| PubChem CID | 86943269 |
| Molecular Formula | C21H25FN2O2 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 1-[cyclopropyl-(4-fluorophenyl)methyl]-3-[1-(3-methoxyphenyl)propan-2-yl]urea |
| SMILES | COc1cccc(CC(C)NC(=O)NC(c2ccc(F)cc2)C2CC2)c1 |
| InChI | InChI=1S/C21H25FN2O2/c1-14(12-15-4-3-5-19(13-15)26-2)23-21(25)24-20(16-6-7-16)17-8-10-18(22)11-9-17/h3-5,8-11,13-14,16,20H,6-7,12H2,1-2H3,(H2,23,24,25) |
| InChIKey | DMCKPZDXEGSGLD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |