C21H27FN2O2 — CID 86943844
1-ethyl-1-[1-(4-fluorophenyl)ethyl]-3-[1-(3-methoxyphenyl)propan-2-yl]urea (PubChem CID 86943844) has the molecular formula C21H27FN2O2 and a molecular weight of 358.46 g/mol. Its IUPAC name is 1-ethyl-1-[1-(4-fluorophenyl)ethyl]-3-[1-(3-methoxyphenyl)propan-2-yl]urea.
| Compound Name | 1-ethyl-1-[1-(4-fluorophenyl)ethyl]-3-[1-(3-methoxyphenyl)propan-2-yl]urea |
|---|---|
| PubChem CID | 86943844 |
| Molecular Formula | C21H27FN2O2 |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 1-ethyl-1-[1-(4-fluorophenyl)ethyl]-3-[1-(3-methoxyphenyl)propan-2-yl]urea |
| SMILES | CCN(C(=O)NC(C)Cc1cccc(OC)c1)C(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H27FN2O2/c1-5-24(16(3)18-9-11-19(22)12-10-18)21(25)23-15(2)13-17-7-6-8-20(14-17)26-4/h6-12,14-16H,5,13H2,1-4H3,(H,23,25) |
| InChIKey | DMCWRAHHHMCQJX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |