C19H23FN2O3 — CID 71919597
1-[cyclopropyl-(4-fluorophenyl)methyl]-3-[4-(furan-2-yl)-4-hydroxybutan-2-yl]urea (PubChem CID 71919597) has the molecular formula C19H23FN2O3 and a molecular weight of 346.40 g/mol. Its IUPAC name is 1-[cyclopropyl-(4-fluorophenyl)methyl]-3-[4-(furan-2-yl)-4-hydroxybutan-2-yl]urea.
| Compound Name | 1-[cyclopropyl-(4-fluorophenyl)methyl]-3-[4-(furan-2-yl)-4-hydroxybutan-2-yl]urea |
|---|---|
| PubChem CID | 71919597 |
| Molecular Formula | C19H23FN2O3 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-[cyclopropyl-(4-fluorophenyl)methyl]-3-[4-(furan-2-yl)-4-hydroxybutan-2-yl]urea |
| SMILES | CC(CC(O)c1ccco1)NC(=O)NC(c1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C19H23FN2O3/c1-12(11-16(23)17-3-2-10-25-17)21-19(24)22-18(13-4-5-13)14-6-8-15(20)9-7-14/h2-3,6-10,12-13,16,18,23H,4-5,11H2,1H3,(H2,21,22,24) |
| InChIKey | YOJFZBZGVIGODK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |