C19H20ClFN2O — CID 41200264
1-[(S)-(4-chlorophenyl)-cyclopropylmethyl]-3-[(1R)-1-(4-fluorophenyl)ethyl]urea (PubChem CID 41200264) has the molecular formula C19H20ClFN2O and a molecular weight of 346.83 g/mol. Its IUPAC name is 1-[(S)-(4-chlorophenyl)-cyclopropylmethyl]-3-[(1R)-1-(4-fluorophenyl)ethyl]urea.
| Compound Name | 1-[(S)-(4-chlorophenyl)-cyclopropylmethyl]-3-[(1R)-1-(4-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 41200264 |
| Molecular Formula | C19H20ClFN2O |
| Molecular Weight | 346.83 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-[(S)-(4-chlorophenyl)-cyclopropylmethyl]-3-[(1R)-1-(4-fluorophenyl)ethyl]urea |
| SMILES | C[C@@H](NC(=O)N[C@H](c1ccc(Cl)cc1)C1CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H20ClFN2O/c1-12(13-6-10-17(21)11-7-13)22-19(24)23-18(14-2-3-14)15-4-8-16(20)9-5-15/h4-12,14,18H,2-3H2,1H3,(H2,22,23,24)/t12-,18+/m1/s1 |
| InChIKey | TXICMUBBFALAJD-XIKOKIGWSA-N |
| XLogP | 4.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.83 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |