C9H7BrF2N2O4 — CID 102854417
2-[(5-bromo-2,4-difluorophenyl)carbamoylamino]oxyacetic acid (PubChem CID 102854417) has the molecular formula C9H7BrF2N2O4 and a molecular weight of 325.07 g/mol. Its IUPAC name is 2-[(5-bromo-2,4-difluorophenyl)carbamoylamino]oxyacetic acid.
| Compound Name | 2-[(5-bromo-2,4-difluorophenyl)carbamoylamino]oxyacetic acid |
|---|---|
| PubChem CID | 102854417 |
| Molecular Formula | C9H7BrF2N2O4 |
| Molecular Weight | 325.07 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | 2-[(5-bromo-2,4-difluorophenyl)carbamoylamino]oxyacetic acid |
| SMILES | O=C(O)CONC(=O)Nc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C9H7BrF2N2O4/c10-4-1-7(6(12)2-5(4)11)13-9(17)14-18-3-8(15)16/h1-2H,3H2,(H,15,16)(H2,13,14,17) |
| InChIKey | IHJILOYTGSVTCN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.07 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|