C21H26FN3O4 — CID 139004489
5-(4-fluorophenyl)-5-methyl-3-[2-(1-oxa-4-azaspiro[5.5]undecan-4-yl)-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 139004489) has the molecular formula C21H26FN3O4 and a molecular weight of 403.45 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-5-methyl-3-[2-(1-oxa-4-azaspiro[5.5]undecan-4-yl)-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 5-(4-fluorophenyl)-5-methyl-3-[2-(1-oxa-4-azaspiro[5.5]undecan-4-yl)-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 139004489 |
| Molecular Formula | C21H26FN3O4 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 5-(4-fluorophenyl)-5-methyl-3-[2-(1-oxa-4-azaspiro[5.5]undecan-4-yl)-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(F)cc2)NC(=O)N(CC(=O)N2CCOC3(CCCCC3)C2)C1=O |
| InChI | InChI=1S/C21H26FN3O4/c1-20(15-5-7-16(22)8-6-15)18(27)25(19(28)23-20)13-17(26)24-11-12-29-21(14-24)9-3-2-4-10-21/h5-8H,2-4,9-14H2,1H3,(H,23,28) |
| InChIKey | ZXDXARMQCJHMSH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|