C21H20FN3O3 — CID 4804767
3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-ethyl-5-(4-fluorophenyl)imidazolidine-2,4-dione (PubChem CID 4804767) has the molecular formula C21H20FN3O3 and a molecular weight of 381.41 g/mol. Its IUPAC name is 3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-ethyl-5-(4-fluorophenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-ethyl-5-(4-fluorophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 4804767 |
| Molecular Formula | C21H20FN3O3 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-ethyl-5-(4-fluorophenyl)imidazolidine-2,4-dione |
| SMILES | CCC1(c2ccc(F)cc2)NC(=O)N(CC(=O)N2CCc3ccccc32)C1=O |
| InChI | InChI=1S/C21H20FN3O3/c1-2-21(15-7-9-16(22)10-8-15)19(27)25(20(28)23-21)13-18(26)24-12-11-14-5-3-4-6-17(14)24/h3-10H,2,11-13H2,1H3,(H,23,28) |
| InChIKey | HFYSYPISWNFOFK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|