C21H19FN4O4 — CID 7181234
(5R)-5-ethyl-5-(4-fluorophenyl)-3-[2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 7181234) has the molecular formula C21H19FN4O4 and a molecular weight of 410.41 g/mol. Its IUPAC name is (5R)-5-ethyl-5-(4-fluorophenyl)-3-[2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-ethyl-5-(4-fluorophenyl)-3-[2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7181234 |
| Molecular Formula | C21H19FN4O4 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | (5R)-5-ethyl-5-(4-fluorophenyl)-3-[2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | CC[C@]1(c2ccc(F)cc2)NC(=O)N(CC(=O)N2CC(=O)Nc3ccccc32)C1=O |
| InChI | InChI=1S/C21H19FN4O4/c1-2-21(13-7-9-14(22)10-8-13)19(29)26(20(30)24-21)12-18(28)25-11-17(27)23-15-5-3-4-6-16(15)25/h3-10H,2,11-12H2,1H3,(H,23,27)(H,24,30)/t21-/m1/s1 |
| InChIKey | RXQAVGCDUYYIGF-OAQYLSRUSA-N |
| XLogP | 1.97 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|