C21H21FN4O — CID 55877092
7-fluoro-2,3-dimethyl-N-(3-pyrrolidin-1-ylphenyl)quinoxaline-5-carboxamide (PubChem CID 55877092) has the molecular formula C21H21FN4O and a molecular weight of 364.42 g/mol. Its IUPAC name is 7-fluoro-2,3-dimethyl-N-(3-pyrrolidin-1-ylphenyl)quinoxaline-5-carboxamide.
| Compound Name | 7-fluoro-2,3-dimethyl-N-(3-pyrrolidin-1-ylphenyl)quinoxaline-5-carboxamide |
|---|---|
| PubChem CID | 55877092 |
| Molecular Formula | C21H21FN4O |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 7-fluoro-2,3-dimethyl-N-(3-pyrrolidin-1-ylphenyl)quinoxaline-5-carboxamide |
| SMILES | Cc1nc2cc(F)cc(C(=O)Nc3cccc(N4CCCC4)c3)c2nc1C |
| InChI | InChI=1S/C21H21FN4O/c1-13-14(2)24-20-18(10-15(22)11-19(20)23-13)21(27)25-16-6-5-7-17(12-16)26-8-3-4-9-26/h5-7,10-12H,3-4,8-9H2,1-2H3,(H,25,27) |
| InChIKey | PRIMCOMBLIILJJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'} |
|---|