C21H21FN4O6 — CID 55892651
N-[4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]-3,4,5-trimethoxy-2-nitrobenzamide (PubChem CID 55892651) has the molecular formula C21H21FN4O6 and a molecular weight of 444.42 g/mol. Its IUPAC name is N-[4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]-3,4,5-trimethoxy-2-nitrobenzamide.
| Compound Name | N-[4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]-3,4,5-trimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 55892651 |
| Molecular Formula | C21H21FN4O6 |
| Molecular Weight | 444.42 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-[4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]-3,4,5-trimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(-n3nc(C)cc3C)c(F)c2)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C21H21FN4O6/c1-11-8-12(2)25(24-11)16-7-6-13(9-15(16)22)23-21(27)14-10-17(30-3)19(31-4)20(32-5)18(14)26(28)29/h6-10H,1-5H3,(H,23,27) |
| InChIKey | ACGJXIMUSRSFGC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|