C23H24FN5O3 — CID 55817771
N-[4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]-5-nitro-2-piperidin-1-ylbenzamide (PubChem CID 55817771) has the molecular formula C23H24FN5O3 and a molecular weight of 437.48 g/mol. Its IUPAC name is N-[4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]-5-nitro-2-piperidin-1-ylbenzamide.
| Compound Name | N-[4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]-5-nitro-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 55817771 |
| Molecular Formula | C23H24FN5O3 |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | N-[4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]-5-nitro-2-piperidin-1-ylbenzamide |
| SMILES | Cc1cc(C)n(-c2ccc(NC(=O)c3cc([N+](=O)[O-])ccc3N3CCCCC3)cc2F)n1 |
| InChI | InChI=1S/C23H24FN5O3/c1-15-12-16(2)28(26-15)22-8-6-17(13-20(22)24)25-23(30)19-14-18(29(31)32)7-9-21(19)27-10-4-3-5-11-27/h6-9,12-14H,3-5,10-11H2,1-2H3,(H,25,30) |
| InChIKey | CLXSKISRIROEKI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|