C26H29FN6O3 — CID 55534402
N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide (PubChem CID 55534402) has the molecular formula C26H29FN6O3 and a molecular weight of 492.56 g/mol. Its IUPAC name is N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide.
| Compound Name | N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 55534402 |
| Molecular Formula | C26H29FN6O3 |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide |
| SMILES | CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)Nc2ccc(F)c(-c3nnc4n3CCCCC4)c2)CC1 |
| InChI | InChI=1S/C26H29FN6O3/c1-17-10-13-31(14-11-17)23-9-7-19(33(35)36)16-21(23)26(34)28-18-6-8-22(27)20(15-18)25-30-29-24-5-3-2-4-12-32(24)25/h6-9,15-17H,2-5,10-14H2,1H3,(H,28,34) |
| InChIKey | GPGFSLKJWMUEAH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|