C24H26N4O5 — CID 38333011
N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide (PubChem CID 38333011) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide.
| Compound Name | N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 38333011 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide |
| SMILES | CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)Nc2ccc(CN3C(=O)CCC3=O)cc2)CC1 |
| InChI | InChI=1S/C24H26N4O5/c1-16-10-12-26(13-11-16)21-7-6-19(28(32)33)14-20(21)24(31)25-18-4-2-17(3-5-18)15-27-22(29)8-9-23(27)30/h2-7,14,16H,8-13,15H2,1H3,(H,25,31) |
| InChIKey | KDUSRLIWTPJCQG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|