C17H19N3O5 — CID 60533512
N-[2-(2,6-dimethylmorpholin-4-yl)phenyl]-5-nitrofuran-2-carboxamide (PubChem CID 60533512) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is N-[2-(2,6-dimethylmorpholin-4-yl)phenyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[2-(2,6-dimethylmorpholin-4-yl)phenyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 60533512 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N-[2-(2,6-dimethylmorpholin-4-yl)phenyl]-5-nitrofuran-2-carboxamide |
| SMILES | CC1CN(c2ccccc2NC(=O)c2ccc([N+](=O)[O-])o2)CC(C)O1 |
| InChI | InChI=1S/C17H19N3O5/c1-11-9-19(10-12(2)24-11)14-6-4-3-5-13(14)18-17(21)15-7-8-16(25-15)20(22)23/h3-8,11-12H,9-10H2,1-2H3,(H,18,21) |
| InChIKey | VBRXABXYDNIKKL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 97.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|