C21H22F3N5O — CID 46581688
N-[4-(diethylamino)phenyl]-5-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide (PubChem CID 46581688) has the molecular formula C21H22F3N5O and a molecular weight of 417.44 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-5-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide.
| Compound Name | N-[4-(diethylamino)phenyl]-5-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46581688 |
| Molecular Formula | C21H22F3N5O |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-5-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2cnn(-c3ccc(C(F)(F)F)cn3)c2C)cc1 |
| InChI | InChI=1S/C21H22F3N5O/c1-4-28(5-2)17-9-7-16(8-10-17)27-20(30)18-13-26-29(14(18)3)19-11-6-15(12-25-19)21(22,23)24/h6-13H,4-5H2,1-3H3,(H,27,30) |
| InChIKey | IVNZXXXJRVNLKT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|