C13H13F3N4O2 — CID 46577649
N-methoxy-N,5-dimethyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide (PubChem CID 46577649) has the molecular formula C13H13F3N4O2 and a molecular weight of 314.27 g/mol. Its IUPAC name is N-methoxy-N,5-dimethyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide.
| Compound Name | N-methoxy-N,5-dimethyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46577649 |
| Molecular Formula | C13H13F3N4O2 |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | N-methoxy-N,5-dimethyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide |
| SMILES | CON(C)C(=O)c1cnn(-c2ccc(C(F)(F)F)cn2)c1C |
| InChI | InChI=1S/C13H13F3N4O2/c1-8-10(12(21)19(2)22-3)7-18-20(8)11-5-4-9(6-17-11)13(14,15)16/h4-7H,1-3H3 |
| InChIKey | WIZIIICJVJBDGH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|