C17H20F3N5O4 — CID 46491304
methyl 6-[[1-(6-methoxypyridazin-3-yl)-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]hexanoate (PubChem CID 46491304) has the molecular formula C17H20F3N5O4 and a molecular weight of 415.37 g/mol. Its IUPAC name is methyl 6-[[1-(6-methoxypyridazin-3-yl)-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]hexanoate.
| Compound Name | methyl 6-[[1-(6-methoxypyridazin-3-yl)-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 46491304 |
| Molecular Formula | C17H20F3N5O4 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | methyl 6-[[1-(6-methoxypyridazin-3-yl)-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)c1cnn(-c2ccc(OC)nn2)c1C(F)(F)F |
| InChI | InChI=1S/C17H20F3N5O4/c1-28-13-8-7-12(23-24-13)25-15(17(18,19)20)11(10-22-25)16(27)21-9-5-3-4-6-14(26)29-2/h7-8,10H,3-6,9H2,1-2H3,(H,21,27) |
| InChIKey | QPTMAQWAJUFRSY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|