C16H21N5O4 — CID 31855775
methyl 4-[[5-ethyl-1-(6-methoxypyridazin-3-yl)pyrazole-4-carbonyl]amino]butanoate (PubChem CID 31855775) has the molecular formula C16H21N5O4 and a molecular weight of 347.38 g/mol. Its IUPAC name is methyl 4-[[5-ethyl-1-(6-methoxypyridazin-3-yl)pyrazole-4-carbonyl]amino]butanoate.
| Compound Name | methyl 4-[[5-ethyl-1-(6-methoxypyridazin-3-yl)pyrazole-4-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 31855775 |
| Molecular Formula | C16H21N5O4 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | methyl 4-[[5-ethyl-1-(6-methoxypyridazin-3-yl)pyrazole-4-carbonyl]amino]butanoate |
| SMILES | CCc1c(C(=O)NCCCC(=O)OC)cnn1-c1ccc(OC)nn1 |
| InChI | InChI=1S/C16H21N5O4/c1-4-12-11(16(23)17-9-5-6-15(22)25-3)10-18-21(12)13-7-8-14(24-2)20-19-13/h7-8,10H,4-6,9H2,1-3H3,(H,17,23) |
| InChIKey | MVFJXASGCBAVAO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|