C16H23N5O2 — CID 31886760
5-ethyl-1-(6-methoxypyridazin-3-yl)-N-[(2R)-pentan-2-yl]pyrazole-4-carboxamide (PubChem CID 31886760) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 5-ethyl-1-(6-methoxypyridazin-3-yl)-N-[(2R)-pentan-2-yl]pyrazole-4-carboxamide.
| Compound Name | 5-ethyl-1-(6-methoxypyridazin-3-yl)-N-[(2R)-pentan-2-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 31886760 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 5-ethyl-1-(6-methoxypyridazin-3-yl)-N-[(2R)-pentan-2-yl]pyrazole-4-carboxamide |
| SMILES | CCC[C@@H](C)NC(=O)c1cnn(-c2ccc(OC)nn2)c1CC |
| InChI | InChI=1S/C16H23N5O2/c1-5-7-11(3)18-16(22)12-10-17-21(13(12)6-2)14-8-9-15(23-4)20-19-14/h8-11H,5-7H2,1-4H3,(H,18,22)/t11-/m1/s1 |
| InChIKey | KRVZWQAVZRXNRH-LLVKDONJSA-N |
| XLogP | 2.15 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |