C22H22N6O2 — CID 39316484
5-ethyl-1-(6-methoxypyridazin-3-yl)-N-(2-quinolin-8-ylethyl)pyrazole-4-carboxamide (PubChem CID 39316484) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 5-ethyl-1-(6-methoxypyridazin-3-yl)-N-(2-quinolin-8-ylethyl)pyrazole-4-carboxamide.
| Compound Name | 5-ethyl-1-(6-methoxypyridazin-3-yl)-N-(2-quinolin-8-ylethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 39316484 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 5-ethyl-1-(6-methoxypyridazin-3-yl)-N-(2-quinolin-8-ylethyl)pyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)NCCc2cccc3cccnc23)cnn1-c1ccc(OC)nn1 |
| InChI | InChI=1S/C22H22N6O2/c1-3-18-17(14-25-28(18)19-9-10-20(30-2)27-26-19)22(29)24-13-11-16-7-4-6-15-8-5-12-23-21(15)16/h4-10,12,14H,3,11,13H2,1-2H3,(H,24,29) |
| InChIKey | BAEDGSQRURJVGY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |