C23H22F3N7O2 — CID 55721930
1-(6-methoxypyridazin-3-yl)-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 55721930) has the molecular formula C23H22F3N7O2 and a molecular weight of 485.47 g/mol. Its IUPAC name is 1-(6-methoxypyridazin-3-yl)-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(6-methoxypyridazin-3-yl)-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55721930 |
| Molecular Formula | C23H22F3N7O2 |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 1-(6-methoxypyridazin-3-yl)-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | COc1ccc(-n2ncc(C(=O)NCCCc3cn(-c4ccccc4)nc3C)c2C(F)(F)F)nn1 |
| InChI | InChI=1S/C23H22F3N7O2/c1-15-16(14-32(31-15)17-8-4-3-5-9-17)7-6-12-27-22(34)18-13-28-33(21(18)23(24,25)26)19-10-11-20(35-2)30-29-19/h3-5,8-11,13-14H,6-7,12H2,1-2H3,(H,27,34) |
| InChIKey | XPENJCHQROEILS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|