C14H17ClN4O2 — CID 103154914
4-amino-N-(5-chloro-2-pyrazol-1-ylphenyl)-3-methoxybutanamide (PubChem CID 103154914) has the molecular formula C14H17ClN4O2 and a molecular weight of 308.77 g/mol. Its IUPAC name is 4-amino-N-(5-chloro-2-pyrazol-1-ylphenyl)-3-methoxybutanamide.
| Compound Name | 4-amino-N-(5-chloro-2-pyrazol-1-ylphenyl)-3-methoxybutanamide |
|---|---|
| PubChem CID | 103154914 |
| Molecular Formula | C14H17ClN4O2 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 4-amino-N-(5-chloro-2-pyrazol-1-ylphenyl)-3-methoxybutanamide |
| SMILES | COC(CN)CC(=O)Nc1cc(Cl)ccc1-n1cccn1 |
| InChI | InChI=1S/C14H17ClN4O2/c1-21-11(9-16)8-14(20)18-12-7-10(15)3-4-13(12)19-6-2-5-17-19/h2-7,11H,8-9,16H2,1H3,(H,18,20) |
| InChIKey | OJOXZGJEVAIKTJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |