C18H18N2O4 — CID 51090288
4-methoxy-3-[(4-oxo-4-phenylbutanoyl)amino]benzamide (PubChem CID 51090288) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 4-methoxy-3-[(4-oxo-4-phenylbutanoyl)amino]benzamide.
| Compound Name | 4-methoxy-3-[(4-oxo-4-phenylbutanoyl)amino]benzamide |
|---|---|
| PubChem CID | 51090288 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 4-methoxy-3-[(4-oxo-4-phenylbutanoyl)amino]benzamide |
| SMILES | COc1ccc(C(N)=O)cc1NC(=O)CCC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O4/c1-24-16-9-7-13(18(19)23)11-14(16)20-17(22)10-8-15(21)12-5-3-2-4-6-12/h2-7,9,11H,8,10H2,1H3,(H2,19,23)(H,20,22) |
| InChIKey | RJIRYFDFFRCCBP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |