C20H21NO5 — CID 119196561
3-[(4-oxo-4-phenylbutanoyl)amino]-4-propan-2-yloxybenzoic acid (PubChem CID 119196561) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is 3-[(4-oxo-4-phenylbutanoyl)amino]-4-propan-2-yloxybenzoic acid.
| Compound Name | 3-[(4-oxo-4-phenylbutanoyl)amino]-4-propan-2-yloxybenzoic acid |
|---|---|
| PubChem CID | 119196561 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 3-[(4-oxo-4-phenylbutanoyl)amino]-4-propan-2-yloxybenzoic acid |
| SMILES | CC(C)Oc1ccc(C(=O)O)cc1NC(=O)CCC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H21NO5/c1-13(2)26-18-10-8-15(20(24)25)12-16(18)21-19(23)11-9-17(22)14-6-4-3-5-7-14/h3-8,10,12-13H,9,11H2,1-2H3,(H,21,23)(H,24,25) |
| InChIKey | IFUMZPWJFDZZKS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |