C19H29NO5 — CID 119196415
3-[3-(4-methylpentan-2-yloxy)propanoylamino]-4-propan-2-yloxybenzoic acid (PubChem CID 119196415) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is 3-[3-(4-methylpentan-2-yloxy)propanoylamino]-4-propan-2-yloxybenzoic acid.
| Compound Name | 3-[3-(4-methylpentan-2-yloxy)propanoylamino]-4-propan-2-yloxybenzoic acid |
|---|---|
| PubChem CID | 119196415 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 3-[3-(4-methylpentan-2-yloxy)propanoylamino]-4-propan-2-yloxybenzoic acid |
| SMILES | CC(C)CC(C)OCCC(=O)Nc1cc(C(=O)O)ccc1OC(C)C |
| InChI | InChI=1S/C19H29NO5/c1-12(2)10-14(5)24-9-8-18(21)20-16-11-15(19(22)23)6-7-17(16)25-13(3)4/h6-7,11-14H,8-10H2,1-5H3,(H,20,21)(H,22,23) |
| InChIKey | RIQHRJZEECKQAM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |