C26H51N3O9Si2 — CID 158429621
prop-2-ynyl N-(3-triethoxysilylpropyl)carbamate;1-prop-2-ynyl-3-(3-triethoxysilylpropyl)urea (PubChem CID 158429621) has the molecular formula C26H51N3O9Si2 and a molecular weight of 605.88 g/mol. Its IUPAC name is prop-2-ynyl N-(3-triethoxysilylpropyl)carbamate;1-prop-2-ynyl-3-(3-triethoxysilylpropyl)urea.
| Compound Name | prop-2-ynyl N-(3-triethoxysilylpropyl)carbamate;1-prop-2-ynyl-3-(3-triethoxysilylpropyl)urea |
|---|---|
| PubChem CID | 158429621 |
| Molecular Formula | C26H51N3O9Si2 |
| Molecular Weight | 605.88 g/mol |
| Exact Mass | 605.32 |
| IUPAC Name | prop-2-ynyl N-(3-triethoxysilylpropyl)carbamate;1-prop-2-ynyl-3-(3-triethoxysilylpropyl)urea |
| SMILES | C#CCNC(=O)NCCC[Si](OCC)(OCC)OCC.C#CCOC(=O)NCCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C13H26N2O4Si.C13H25NO5Si/c1-5-10-14-13(16)15-11-9-12-20(17-6-2,18-7-3)19-8-4;1-5-11-16-13(15)14-10-9-12-20(17-6-2,18-7-3)19-8-4/h1H,6-12H2,2-4H3,(H2,14,15,16);1H,6-12H2,2-4H3,(H,14,15) |
| InChIKey | HBMOMGIIADZNAV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 134.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.88 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|