About prop-2-ynyl N-(3-triethoxysilylpropyl)carbamoperoxoate
prop-2-ynyl N-(3-triethoxysilylpropyl)carbamoperoxoate (PubChem CID 90477209) has the molecular formula C13H25NO6Si
and a molecular weight of 319.43 g/mol. Its IUPAC name is prop-2-ynyl N-(3-triethoxysilylpropyl)carbamoperoxoate.
Molecular Properties
| Compound Name | prop-2-ynyl N-(3-triethoxysilylpropyl)carbamoperoxoate |
| PubChem CID | 90477209 |
| Molecular Formula | C13H25NO6Si |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | prop-2-ynyl N-(3-triethoxysilylpropyl)carbamoperoxoate |
| SMILES | C#CCOOC(=O)NCCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C13H25NO6Si/c1-5-11-16-20-13(15)14-10-9-12-21(17-6-2,18-7-3)19-8-4/h1H,6-12H2,2-4H3,(H,14,15) |
| InChIKey | VGQDVUZNCPBVQY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl N-(3-triethoxysilylpropyl)carbamoperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl N-(3-triethoxysilylpropyl)carbamoperoxoate?
The IUPAC name of prop-2-ynyl N-(3-triethoxysilylpropyl)carbamoperoxoate (CID 90477209) is prop-2-ynyl N-(3-triethoxysilylpropyl)carbamoperoxoate.
What is the SMILES notation for prop-2-ynyl N-(3-triethoxysilylpropyl)carbamoperoxoate?
The canonical SMILES for prop-2-ynyl N-(3-triethoxysilylpropyl)carbamoperoxoate is C#CCOOC(=O)NCCC[Si](OCC)(OCC)OCC.
What is the InChIKey of prop-2-ynyl N-(3-triethoxysilylpropyl)carbamoperoxoate?
The InChIKey is VGQDVUZNCPBVQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO6Si/c1-5-11-16-20-13(15)14-10-9-12-21(17-6-2,18-7-3)19-8-4/h1H,6-12H2,2-4H3,(H,14,15).
What are the key properties of prop-2-ynyl N-(3-triethoxysilylpropyl)carbamoperoxoate?
prop-2-ynyl N-(3-triethoxysilylpropyl)carbamoperoxoate has a molecular weight of 319.43 g/mol, XLogP of 1.72, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl N-(3-triethoxysilylpropyl)carbamoperoxoate is sourced from PubChem (CID 90477209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).