C13H32N2O4Si — CID 87438219
2-aminoacetaldehyde;3-[diethoxy-[(2-methylpropan-2-yl)oxy]silyl]propan-1-amine (PubChem CID 87438219) has the molecular formula C13H32N2O4Si and a molecular weight of 308.50 g/mol. Its IUPAC name is 2-aminoacetaldehyde;3-[diethoxy-[(2-methylpropan-2-yl)oxy]silyl]propan-1-amine.
| Compound Name | 2-aminoacetaldehyde;3-[diethoxy-[(2-methylpropan-2-yl)oxy]silyl]propan-1-amine |
|---|---|
| PubChem CID | 87438219 |
| Molecular Formula | C13H32N2O4Si |
| Molecular Weight | 308.50 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 2-aminoacetaldehyde;3-[diethoxy-[(2-methylpropan-2-yl)oxy]silyl]propan-1-amine |
| SMILES | CCO[Si](CCCN)(OCC)OC(C)(C)C.NCC=O |
| InChI | InChI=1S/C11H27NO3Si.C2H5NO/c1-6-13-16(14-7-2,10-8-9-12)15-11(3,4)5;3-1-2-4/h6-10,12H2,1-5H3;2H,1,3H2 |
| InChIKey | ZRYUJEKJUPOOTB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.50 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|