C41H97N3O17Si3 — CID 157496346
3-[3-aminopropyl(diethoxy)silyl]oxy-3-methylpentane-1,5-diol;N-(3-trimethoxysilylpropyl)butan-1-amine;3-[tris[2-(2-methoxyethoxy)ethoxy]silyl]propan-1-amine (PubChem CID 157496346) has the molecular formula C41H97N3O17Si3 and a molecular weight of 988.49 g/mol. Its IUPAC name is 3-[3-aminopropyl(diethoxy)silyl]oxy-3-methylpentane-1,5-diol;N-(3-trimethoxysilylpropyl)butan-1-amine;3-[tris[2-(2-methoxyethoxy)ethoxy]silyl]propan-1-amine.
| Compound Name | 3-[3-aminopropyl(diethoxy)silyl]oxy-3-methylpentane-1,5-diol;N-(3-trimethoxysilylpropyl)butan-1-amine;3-[tris[2-(2-methoxyethoxy)ethoxy]silyl]propan-1-amine |
|---|---|
| PubChem CID | 157496346 |
| Molecular Formula | C41H97N3O17Si3 |
| Molecular Weight | 988.49 g/mol |
| Exact Mass | 987.61 |
| IUPAC Name | 3-[3-aminopropyl(diethoxy)silyl]oxy-3-methylpentane-1,5-diol;N-(3-trimethoxysilylpropyl)butan-1-amine;3-[tris[2-(2-methoxyethoxy)ethoxy]silyl]propan-1-amine |
| SMILES | CCCCNCCC[Si](OC)(OC)OC.CCO[Si](CCCN)(OCC)OC(C)(CCO)CCO.COCCOCCO[Si](CCCN)(OCCOCCOC)OCCOCCOC |
| InChI | InChI=1S/C18H41NO9Si.C13H31NO5Si.C10H25NO3Si/c1-20-6-9-23-12-15-26-29(18-4-5-19,27-16-13-24-10-7-21-2)28-17-14-25-11-8-22-3;1-4-17-20(18-5-2,12-6-9-14)19-13(3,7-10-15)8-11-16;1-5-6-8-11-9-7-10-15(12-2,13-3)14-4/h4-19H2,1-3H3;15-16H,4-12,14H2,1-3H3;11H,5-10H2,1-4H3 |
| InChIKey | BXWLCTVTFSWGQZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 242.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 988.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|