About N-methyl-3-trimethoxysilylpropan-1-amine;3-[tris(2-methoxyethoxy)silyl]propan-1-amine
N-methyl-3-trimethoxysilylpropan-1-amine;3-[tris(2-methoxyethoxy)silyl]propan-1-amine (PubChem CID 157071807) has the molecular formula C19H48N2O9Si2
and a molecular weight of 504.77 g/mol. Its IUPAC name is N-methyl-3-trimethoxysilylpropan-1-amine;3-[tris(2-methoxyethoxy)silyl]propan-1-amine.
Molecular Properties
| Compound Name | N-methyl-3-trimethoxysilylpropan-1-amine;3-[tris(2-methoxyethoxy)silyl]propan-1-amine |
| PubChem CID | 157071807 |
| Molecular Formula | C19H48N2O9Si2 |
| Molecular Weight | 504.77 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | N-methyl-3-trimethoxysilylpropan-1-amine;3-[tris(2-methoxyethoxy)silyl]propan-1-amine |
| SMILES | CNCCC[Si](OC)(OC)OC.COCCO[Si](CCCN)(OCCOC)OCCOC |
| InChI | InChI=1S/C12H29NO6Si.C7H19NO3Si/c1-14-6-9-17-20(12-4-5-13,18-10-7-15-2)19-11-8-16-3;1-8-6-5-7-12(9-2,10-3)11-4/h4-13H2,1-3H3;8H,5-7H2,1-4H3 |
| InChIKey | ACNBXCXFIWHXQZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.77 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-3-trimethoxysilylpropan-1-amine;3-[tris(2-methoxyethoxy)silyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-trimethoxysilylpropan-1-amine;3-[tris(2-methoxyethoxy)silyl]propan-1-amine?
The IUPAC name of N-methyl-3-trimethoxysilylpropan-1-amine;3-[tris(2-methoxyethoxy)silyl]propan-1-amine (CID 157071807) is N-methyl-3-trimethoxysilylpropan-1-amine;3-[tris(2-methoxyethoxy)silyl]propan-1-amine.
What is the SMILES notation for N-methyl-3-trimethoxysilylpropan-1-amine;3-[tris(2-methoxyethoxy)silyl]propan-1-amine?
The canonical SMILES for N-methyl-3-trimethoxysilylpropan-1-amine;3-[tris(2-methoxyethoxy)silyl]propan-1-amine is CNCCC[Si](OC)(OC)OC.COCCO[Si](CCCN)(OCCOC)OCCOC.
What is the InChIKey of N-methyl-3-trimethoxysilylpropan-1-amine;3-[tris(2-methoxyethoxy)silyl]propan-1-amine?
The InChIKey is ACNBXCXFIWHXQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H29NO6Si.C7H19NO3Si/c1-14-6-9-17-20(12-4-5-13,18-10-7-15-2)19-11-8-16-3;1-8-6-5-7-12(9-2,10-3)11-4/h4-13H2,1-3H3;8H,5-7H2,1-4H3.
What are the key properties of N-methyl-3-trimethoxysilylpropan-1-amine;3-[tris(2-methoxyethoxy)silyl]propan-1-amine?
N-methyl-3-trimethoxysilylpropan-1-amine;3-[tris(2-methoxyethoxy)silyl]propan-1-amine has a molecular weight of 504.77 g/mol, XLogP of 0.74, 22 rotatable bonds, 2 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-trimethoxysilylpropan-1-amine;3-[tris(2-methoxyethoxy)silyl]propan-1-amine is sourced from PubChem (CID 157071807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).